Portfolio Our Main Products List
Below are the main APIs and Intermediates we currently offer. Feel free to ask us for further details and quotes.
APIs & Intermediates List
Serial number | Category | Product Name | CAS No. | Click to view Structure |
---|---|---|---|---|
1 | Edoxaban Intermediate and API | tert-butyl((1R,2S,5S)-2-(2-((5-chloropyridin-2-yl)amino)-2-oxoa cetamido)-5-(dimethylcarbamoyl)cyclohexyl)carbamate | 480452-36-6 | >>More information |
2 | N1-((1S,2R,4S)-2-amino-4-(dimethylcarbamoyl)cyclohexyl)-N2-( 5-chloropyridin-2-yl)oxalamide p-Toluenesulfonic acid | 480452-37-7 (free base) | >>More information | |
3 | N-(5-chloropyridin-2-yl)-N'-[(1S,2R,4S)-4-(N,N-dimethylcarba moyl)-2-(5-methyl-4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridine -2-carboxamido)cyclohexyl]oxamide | 480449-70-5 | >>More information | |
4 | Edoxaban | 1229194- 11-9 | >>More information | |
5 | Salkubatrol and valsartan sodium Intermediate and API | (2R,4S)-ethyl 5-([1,1'-biphenyl]-4-yl)-4-amino-2-methylpentanoate hydrochloride | 149690- 12-0 | >>More information |
6 | calcium 4-(((2S,4R)- 1-([1,1'-biphenyl]-4-yl)-5-ethoxy-4-methyl-5-oxope ntan-2-yl)amino)-4-oxobutanoate | 1369773-39-6 | >>More information | |
7 | sodium 4-(((2S,4R)- 1-([1,1'-biphenyl]-4-yl)-5-ethoxy-4-methyl-5-oxope ntan-2-yl)amino)-4-oxobutanoate sodium (S)-5-(4'-((N-(1-carboxylato-2-methylpropyl)pentanamido)methy l)-[1,1'-biphenyl]-2-yl)tetrazol- 1-ide hydrate | 936623-90-4 | >>More information | |
8 | Parecoxib Sodium Intermediate and API | 4-(5-methyl-3-phenylisoxazol-4-yl)benzene- 1-sulfonyl chloride | 509074-26-4 | >>More information |
9 | 4-(5-methyl-3-phenylisoxazol-4-yl)benzenesulfonamide | 181695-72-7 | >>More information | |
10 | N-((4-(5-methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)propiona mide | 198470-84-7 | >>More information | |
11 | Parecoxib Sodium | 198470-85-8 | >>More information | |
12 | Macitentan Intermediate and API | N-[5-(4-Bromophenyl)-6-chloro-4-pyrimidinyl]-N'-propylsulfam ide | 1393813-42-7 | >>More information |
13 | N-[5-(4-Bromophenyl)-6-(2-hydroxyethoxy)-4-pyrimidinyl]-N'-propylsulfamide | 1393813-43-8 | >>More information | |
14 | Macitentan | 441798-33-0 | >>More information | |
15 | Olaparib Intermediate and API | 2-Fluoro-5-[(3-oxo- 1(3H)-isobenzofuranylidene)methyl]-benzon itrile | 763114-25-6 | >>More information |
16 | 2-fluoro-5-((4-oxo-3,4-dihydrophthalazin- 1-yl)Methyl)benzoic acid | 763114-26-7 | >>More information | |
17 | Olaparib | 763113-22-0 | >>More information | |
18 | Tenofovir alafenamide hemifumarate Intermediate and API | [(1R)-2-(6-aminopurin-9-yl)- 1-methylethoxy]methylphenoxypho sphinic acid | 379270-35-6 | >>More information |
19 | Tenofovir Alafenamide | 379270-37-8 | >>More information | |
20 | Tenofovir Alafenamide Fumarate | 1392275-56-7 | >>More information | |
21 | Pazopanib Hydrochloride Intermediate and API | N-(2-chloropyrimidin-4-yl)-2,3-dimethyl-2H-indazol-6-amine | 444731-74-2 | >>More information |
22 | N-(2-chloropyrimidin-4-yl)-N,2,3-trimethyl-2H-indazol-6-amine | 444731-75-3 | >>More information | |
23 | Pazopanib Hydrochloride | 635702-64-6 | >>More information | |
24 | Elagolix Sodium Intermediate and API | 5-(2-Fluoro-3-methoxyphenyl)- 1-[[2-fluoro-6-(trifluoromethyl)p henyl]methyl]-6-methyl-2,4(1H,3H)-pyrimidinedione | 1150560-59-0 | >>More information |
25 | N-[(1R)-2-[(Methylsulfonyl)oxy]- 1-phenylethyl]carbamic acid 1,1-dimethylethyl ester | 102089-75-8 | >>More information | |
26 | 3-[(2R)-2-Amino-2-phenylethyl]-5-(2-fluoro-3-methoxyphenyl)- 1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methyl-2,4(1H, 3H)-pyrimidinedione | 830346-50-4 | >>More information | |
27 | 4-[[(1R)-2-[5-(2-fluoro-3-methoxyphenyl)-3-[[2-fluoro-6-(trifluo romethyl)phenyl]methyl]-3,6-dihydro-4-methyl-2,6-dioxo- 1(2H) -pyrimidinyl]- 1-phenylethyl]amino]-, ethyl ester | 832720-84-0 | >>More information | |
28 | Edoxaban Intermediate and API | 832720-36-2 | >>More information | |
29 | Rivaroxaban Intermediate and API | 2-[(2R)-2-Hydroxy-3-[[4-(3-oxo-4-morpholinyl)phenyl]amino]pr opyl]- 1H-isoindole- 1,3(2H)-dione | 446292-07-5 | >>More information |
30 | (S)-2-((2-oxo-3-(4-(3-oxoMorpholino)phenyl)oxazolidin-5-yl)M ethyl)isoindoline- 1,3-dione | 446292-08-6 | >>More information | |
31 | (S)-4-(4-(5-(aminomethyl)-2-oxooxazolidin-3-yl)phenyl)morpho lin-3-one | 446292- 10-0 | >>More information | |
32 | (S)-5-chloro-N-((2-oxo-3-(4-(3-oxomorpholino)phenyl)oxazolidi n-5-yl)methyl)thiophene-2-carboxamide | 366789-02-8 | >>More information | |
33 | Apixaban Intermediate and API | ethyl 6-(4-(5-chloropentanamido)phenyl)- 1-(4-methoxyphenyl)-7-oxo- 4,5,6,7-tetrahydro- 1H-pyrazolo[3,4-c]pyridine-3-carboxylate | 1421823-20-2 | >>More information |
34 | ethyl 1-(4-methoxyphenyl)-7-oxo-6-(4-(2-oxopiperidin- 1-yl)phenyl)-4, 5,6,7-tetrahydro- 1H-pyrazolo[3,4-c]pyridine-3-carboxylate | 503614-91-3 | >>More information | |
35 | Apixaban | 503612-47-3 | >>More information | |
36 | Ibrutinib Intermediate and API | 5-amino-3-(4-phenoxyphenyl)- 1H-pyrazole-4-carbonitrile | 330792-70-6 | >>More information |
37 | 3-(4-phenoxyphenyl)- 1H-pyrazolo[3,4-d]pyrimidin-4-amine | 330786-24-8 | >>More information | |
38 | (R)-3-(4-phenoxyphenyl)- 1-(piperidin-3-yl)- 1H-pyrazolo[3,4-d]p yrimidin-4-amine | 1022150- 12-4 | >>More information | |
39 | Ibrutinib | 936563-96- 1 | >>More information | |
40 | Elagolix intermediates | 1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-6-methylpyrimidine-2,4-dione | 830346-47-9 | >>More information |
41 | 5-bromo-1-(2-fluoro-6-(trifluoromethyl)benzyl)-6-methylpyrimidine-2,4(1H,3H)-dione | 830346-48-0 | >>More information | |
42 | 1-[[2-fluoro-6-(trifluoromethyl)phenyl]methyl]-5-iodo-6-methylpyrimidine-2,4-dione | 1150560-54-5 | >>More information | |
43 | Avibactam intermediate | ethyl(2S,5R)-5-[(benzyloxy)amino]piperidine-2-carboxylate ethanedioate | 1416134-48-9 | >>More information |
44 | Rosadustat intermediates | methyl 4-hydroxy-7-phenoxyisoquinoline-3-carboxylate | 1455091-10-7 | >>More information |
45 | methyl 2-[(4-methylphenyl)sulfonylamino]acetate | 2645-02-5 | >>More information | |
46 | methyl 4-hydroxy-1-methyl-7-phenoxyisoquinoline-3-carboxylate | 1421312-34-6 | >>More information | |
47 | Vonoprazan intermediate | 5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile | 1240948-77-9 | >>More information |
48 | Pyridine-3-Sulfonyl Chloride | 16133-25-8 | >>More information | |
49 | Tirofiban intermediate | 4-(4-chlorobutyl)pyridine,hydrochloride | 149463-65-0 | >>More information |
50 | Ensitrelvir (S-217622)intermediate | 3-tert-butyl-6-(ethylthio)-1,3,5-triazine-2,4(1H,3H)-dione | 1360105-53-8 | >>More information |
51 | 3-(Chloromethyl)-1-methyl-1h-1,2,4-triazole HCL | 135206-76-7 | >>More information | |
52 | 6-chloro-2-methyl-2H-indazol-5-amine | 1893125-36-4 | >>More information | |
53 | Isavuconazole intermediate | 1-(2,5-difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone | 1157938-97-0 | >>More information |
54 | 4-(2-bromoacetyl)benzonitrile | 20099-89-2 | >>More information | |
55 | Carfilzomib intermediate | 2-morpholin-4-ylacetic acid | 3235-69-6 | >>More information |
56 | (S)-2-Amino-4-methyl-1-((R)-2-methyloxiran-2-yl)pentan-1-one 2,2,2-trifluoroacetate | 247068-85-5 | >>More information | |
57 | Relugolix intermediate | ethyl 2-((2,6-difluorobenzyl)(ethoxycarbonyl)amino)-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylate | 308831-94-9 | >>More information |
58 | ethyl 2-((2,6-difluorobenzyl)(ethoxycarbonyl)amino)-4-((dimethylamino)methyl)-5-(4-nitrophenyl)thiophene-3-carboxylate | 1589503-97-8 | >>More information | |
59 | 2-((2,6-difluorobenzyl)(ethoxycarbonyl)amino)-4-((dimethylamino)methyl)-5-(4-nitrophenyl)thiophene-3-carboxylic acid | 1589503-95-6 | >>More information | |
60 | 3-carboxylicacid,2-[[(2,6-difluorophenyl)methyl](propoxycarbonyl)amino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)-, ethyl ester | 2591260-09-0 | >>More information | |
61 | 3-AMINO-6-METHOXYPYRIDAZINE | 7252-84-8 | >>More information | |
62 | Brexpiprazole intermediate | 4-Bromobenzo[b]thiophene | 5118-13-8 | >>More information |
63 | 7-hydroxy-1H-quinolin-2-one | 70500-72-0 | >>More information | |
64 | Afromoterol intermediate | 4'-Hydroxy-3'-nitroacetophenone | 6322-56-1 | >>More information |
65 | 1-(4-(Benzyloxy)-3-nitrophenyl)ethanone | 14347-05-8 | >>More information | |
66 | 2-Bromo-4'-benzyloxy-3'-nitroacetophenone | 43229-01-2 | >>More information | |
67 | (R)-(-)-1-(4'-methoxyphenyl)-2-benzylaminopropane | 67346-60-5 | >>More information | |
68 | Dabrafenib intermediate | methyl 3-amino-2-fluorobenzoate | 1195768-18-3 | >>More information |
69 | 2-Chloro-4-methylpyrimidine | 13036-57-2 | >>More information | |
70 | 2,6-Difluorobenzenesulfonyl chloride | 60230-36-6 | >>More information | |
71 | Trametinib intermediate | 1-Cyclopropyl-3-(2-fluoro-4-iodophenyl)urea | 871700-18-4 | >>More information |
72 | 3-Cyclopropyl-1-(2-fluoro-4-iodophenyl)-5-hydroxy-6,8-dimethylpyr ido[2,3-d]pyrimidine-2,4,7(1H,3H,8H)-trione | 871700-24-2 | >>More information | |
73 | Teneligliptin intermediate | 1-(3-Methyl-1-phenyl-1H-pyrazol-5-yl)piperazine | 401566-79-8 | >>More information |
74 | Cinitapride hydrogen intermediate | 4-Amino-2-ethoxy-5-nitrobenzoic acid | 86718-18-5 | >>More information |
75 | 4-(AcetylaMino)-2-ethoxy-5-nitrobenzoic Acid Methyl Ester | 86718-16-3 | >>More information | |
76 | Bortezomib / Ixazomib intermediate | (aR,3aS,4S,6S,7aR)-Hexahydro-3a,8,8-trimethyl-alpha-(2-methylpropyl)-4,6-methano-1,3,2-benzodioxaborole-2-methanamine 2,2,2-trifluoroacetate | 179324-87-9 | >>More information |
77 | Bortezomib intermediate | (S)-3-phenyl-2-[(pyrazin-2-ylcarbonyl)amino] propanoic acid | 114457-94-2 | >>More information |
78 | Crisaborole intermediates | 2-Bromo-5-(hydroxy)benzaldehyde | 2973-80-0 | >>More information |
79 | 4-(4-Bromo-3-formylphenoxy)benzonitrile | 906673-54-9 | >>More information | |
80 | Ozenoxacin intermediates | (z)-ethyl-3-(cyclopropylamino)-2-(2,4-dichloro-3-methylbenzoyl)acrylate | 103877-38-9 | >>More information |
81 | [6-[benzoyl(methyl)amino]-5-methyl-3-pyridyl]boronic acid | 446299-81-6 | >>More information | |
82 | Edoxaban intermediate | Tert-Butyl(1R,2S,5S)-2-amino-5-[(dimethylamino)carbonyl]cyclohexylcarbamate oxalic acid | 1210348-34-7 | >>More information |
83 | tert-butyl N-[(1R,2S,5S)-2-amino-5-(dimethylcarbamoyl)cyclohexyl]carbamate | 365998-36-3 | >>More information | |
84 | 4,5,6,7-tetrahydro-5-Methyl-Thiazolo[5,4-c]pyridine-2-carboxylic acid hydrochloride | 720720-96-7 | >>More information | |
85 | Lutathera intermediate | tri-tert-butyl 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetate | 137076-54-1 | >>More information |
86 | Semaglutide intermediate | (S)-22-(tert-butoxycarbonyl)-43,43-dimethyl-10,19,24,41-tetraoxo-3,6,12,15,42-pentaoxa-9,18,23-triazatetratetracontanoic acid | 1118767-16-0 | >>More information |
87 | Gilteritinib intermediate | 3-bromo-6-ethyl-5-((tetrahydro-2H-pyran-4-yl)amino)pyrazine-2-carbonitrile | 1254058-34-8 | >>More information |
88 | 3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]aniline | 1336454-90-0 | >>More information | |
89 | MRTX0902 intermediate | (R)-3-(1-Aminoethyl)-2-methylbenzonitrile | 1336454-90-0 | >>More information |
90 | 5-Bromo-2-chloroisonicotinic acid | 886365-31-7 | >>More information | |
91 | 4-methyl-7-morpholine pyridine and [3, 4-D] pyrazine-1 (2H) -ketone | 2654746-76-4 | >>More information | |
92 | 4- (1-chloro-4-methyl-1, 2-dihydropyridino [3, 4-D] pyriazine-7-yl) morpholine | 2654746-77-5 | >>More information | |
93 | Vitamin K1 | Vitamin K1 | 84-80-0 | >>More information |
94 | AMG-510 | 4-(4-acryloyl-2-methylpiperazin-1-yl)-6-fluoro-7-(2-fluoro-6-hydroxyphenyl)-1-(2-isopropyl-4-methylpyridin-3-yl)pyrido[2,3-d]pyrimidin-2(1H)-one | 2296729-00-3 | >>More information |
95 | MRTX0902 | (R) - 2-methyl-3 - (1 - ((4-methyl-7-morpholinopyrido [3,4-d] pyridazin-1-yl) amino) ethyl) benzonitrile | 2654743-22-1 | >>More information |
96 | MRTX-849 | (2S)-4-[7-(8-Chloro-1-naphthalene)-5,6,7,8-tetrahydro-2-[[((2S)-1-methyl-2-pyrrolidinyl] Methoxy]pyridyl[3,4-d]pyrimidin-4-yl]-1-(2-fluoro-1-oxo-2-propen-1-yl)-2-piperazineacetonitrile | 2326521-71-3 | >>More information |
97 | Gilteritinib | 6-ethyl-3-({3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl}amino)-5-(tetrahydro-2H-pyran-4-ylamino)pyrazine-2-carboxamide | 1254053-43-4 | >>More information |
Serial number | Category | Product Name | CAS No. | Click to view Structure |
Great talented R&D Working with the MageBio Team
Send your inquiry now.
Let us help you catapult your idea into a reality. There’s no better day.